C16H11ClN6O4 — CID 22539093
4-[[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid (PubChem CID 22539093) has the molecular formula C16H11ClN6O4 and a molecular weight of 386.76 g/mol. Its IUPAC name is 4-[[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid.
| Compound Name | 4-[[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 22539093 |
| Molecular Formula | C16H11ClN6O4 |
| Molecular Weight | 386.76 g/mol |
| Exact Mass | 386.05 |
| IUPAC Name | 4-[[6-[(2-chloro-3-pyridinyl)amino]-5-nitropyrimidin-4-yl]amino]benzoic acid |
| SMILES | O=C(O)c1ccc(Nc2ncnc(Nc3cccnc3Cl)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H11ClN6O4/c17-13-11(2-1-7-18-13)22-15-12(23(26)27)14(19-8-20-15)21-10-5-3-9(4-6-10)16(24)25/h1-8H,(H,24,25)(H2,19,20,21,22) |
| InChIKey | OYEUXPKHIWLRRJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 143.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.76 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|