C17H15ClN6O3 — CID 22539023
4-N-(2-chloro-3-pyridinyl)-6-N-(2-ethoxyphenyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22539023) has the molecular formula C17H15ClN6O3 and a molecular weight of 386.80 g/mol. Its IUPAC name is 4-N-(2-chloro-3-pyridinyl)-6-N-(2-ethoxyphenyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(2-ethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22539023 |
| Molecular Formula | C17H15ClN6O3 |
| Molecular Weight | 386.80 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 4-N-(2-chloro-3-pyridinyl)-6-N-(2-ethoxyphenyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCOc1ccccc1Nc1ncnc(Nc2cccnc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15ClN6O3/c1-2-27-13-8-4-3-6-11(13)22-16-14(24(25)26)17(21-10-20-16)23-12-7-5-9-19-15(12)18/h3-10H,2H2,1H3,(H2,20,21,22,23) |
| InChIKey | CVYKUGWRHDKOFT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|