C22H20N6O3 — CID 22539029
6-N-(2-ethoxyphenyl)-4-N-(2-methylquinolin-5-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22539029) has the molecular formula C22H20N6O3 and a molecular weight of 416.44 g/mol. Its IUPAC name is 6-N-(2-ethoxyphenyl)-4-N-(2-methylquinolin-5-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-ethoxyphenyl)-4-N-(2-methylquinolin-5-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22539029 |
| Molecular Formula | C22H20N6O3 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 6-N-(2-ethoxyphenyl)-4-N-(2-methylquinolin-5-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCOc1ccccc1Nc1ncnc(Nc2cccc3nc(C)ccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H20N6O3/c1-3-31-19-10-5-4-7-18(19)27-22-20(28(29)30)21(23-13-24-22)26-17-9-6-8-16-15(17)12-11-14(2)25-16/h4-13H,3H2,1-2H3,(H2,23,24,26,27) |
| InChIKey | BNSKXCNMDNJFJZ-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 115.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|