C19H15N7O2 — CID 22528062
4-N-(2-methylquinolin-5-yl)-5-nitro-6-N-pyridin-3-ylpyrimidine-4,6-diamine (PubChem CID 22528062) has the molecular formula C19H15N7O2 and a molecular weight of 373.38 g/mol. Its IUPAC name is 4-N-(2-methylquinolin-5-yl)-5-nitro-6-N-pyridin-3-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-methylquinolin-5-yl)-5-nitro-6-N-pyridin-3-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22528062 |
| Molecular Formula | C19H15N7O2 |
| Molecular Weight | 373.38 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 4-N-(2-methylquinolin-5-yl)-5-nitro-6-N-pyridin-3-ylpyrimidine-4,6-diamine |
| SMILES | Cc1ccc2c(Nc3ncnc(Nc4cccnc4)c3[N+](=O)[O-])cccc2n1 |
| InChI | InChI=1S/C19H15N7O2/c1-12-7-8-14-15(23-12)5-2-6-16(14)25-19-17(26(27)28)18(21-11-22-19)24-13-4-3-9-20-10-13/h2-11H,1H3,(H2,21,22,24,25) |
| InChIKey | WFFMXLWAVMRVCW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|