C22H15N7O2 — CID 22537644
5-nitro-4-N,6-N-di(quinolin-5-yl)pyrimidine-4,6-diamine (PubChem CID 22537644) has the molecular formula C22H15N7O2 and a molecular weight of 409.41 g/mol. Its IUPAC name is 5-nitro-4-N,6-N-di(quinolin-5-yl)pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N,6-N-di(quinolin-5-yl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22537644 |
| Molecular Formula | C22H15N7O2 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | 5-nitro-4-N,6-N-di(quinolin-5-yl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2cccc3ncccc23)ncnc1Nc1cccc2ncccc12 |
| InChI | InChI=1S/C22H15N7O2/c30-29(31)20-21(27-18-9-1-7-16-14(18)5-3-11-23-16)25-13-26-22(20)28-19-10-2-8-17-15(19)6-4-12-24-17/h1-13H,(H2,25,26,27,28) |
| InChIKey | LUOUJPLTIGBHLV-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|