C15H15N7O2 — CID 22528153
N-[6-(2,2-dimethylhydrazinyl)-5-nitropyrimidin-4-yl]quinolin-5-amine (PubChem CID 22528153) has the molecular formula C15H15N7O2 and a molecular weight of 325.33 g/mol. Its IUPAC name is N-[6-(2,2-dimethylhydrazinyl)-5-nitropyrimidin-4-yl]quinolin-5-amine.
| Compound Name | N-[6-(2,2-dimethylhydrazinyl)-5-nitropyrimidin-4-yl]quinolin-5-amine |
|---|---|
| PubChem CID | 22528153 |
| Molecular Formula | C15H15N7O2 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | N-[6-(2,2-dimethylhydrazinyl)-5-nitropyrimidin-4-yl]quinolin-5-amine |
| SMILES | CN(C)Nc1ncnc(Nc2cccc3ncccc23)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H15N7O2/c1-21(2)20-15-13(22(23)24)14(17-9-18-15)19-12-7-3-6-11-10(12)5-4-8-16-11/h3-9H,1-2H3,(H2,17,18,19,20) |
| InChIKey | BWTDKLVXHWWPNB-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|