C18H12ClN7O2 — CID 22531222
4-N-(5-chloro-2-pyridinyl)-5-nitro-6-N-quinolin-5-ylpyrimidine-4,6-diamine (PubChem CID 22531222) has the molecular formula C18H12ClN7O2 and a molecular weight of 393.79 g/mol. Its IUPAC name is 4-N-(5-chloro-2-pyridinyl)-5-nitro-6-N-quinolin-5-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(5-chloro-2-pyridinyl)-5-nitro-6-N-quinolin-5-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22531222 |
| Molecular Formula | C18H12ClN7O2 |
| Molecular Weight | 393.79 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 4-N-(5-chloro-2-pyridinyl)-5-nitro-6-N-quinolin-5-ylpyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(Nc2ccc(Cl)cn2)ncnc1Nc1cccc2ncccc12 |
| InChI | InChI=1S/C18H12ClN7O2/c19-11-6-7-15(21-9-11)25-18-16(26(27)28)17(22-10-23-18)24-14-5-1-4-13-12(14)3-2-8-20-13/h1-10H,(H2,21,22,23,24,25) |
| InChIKey | UUVQDHTZZRHBIH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 118.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.79 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|