C22H26N6O5S — CID 22527908
4-[[6-(2-ethoxyanilino)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide (PubChem CID 22527908) has the molecular formula C22H26N6O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is 4-[[6-(2-ethoxyanilino)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide.
| Compound Name | 4-[[6-(2-ethoxyanilino)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
|---|---|
| PubChem CID | 22527908 |
| Molecular Formula | C22H26N6O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | 4-[[6-(2-ethoxyanilino)-5-nitropyrimidin-4-yl]amino]-N,N-diethylbenzenesulfonamide |
| SMILES | CCOc1ccccc1Nc1ncnc(Nc2ccc(S(=O)(=O)N(CC)CC)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C22H26N6O5S/c1-4-27(5-2)34(31,32)17-13-11-16(12-14-17)25-21-20(28(29)30)22(24-15-23-21)26-18-9-7-8-10-19(18)33-6-3/h7-15H,4-6H2,1-3H3,(H2,23,24,25,26) |
| InChIKey | BPOHYAYPUNFNBM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|