C21H22FN7O5S — CID 22527842
N,N-diethyl-4-[[6-[2-(4-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzenesulfonamide (PubChem CID 22527842) has the molecular formula C21H22FN7O5S and a molecular weight of 503.52 g/mol. Its IUPAC name is N,N-diethyl-4-[[6-[2-(4-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[[6-[2-(4-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 22527842 |
| Molecular Formula | C21H22FN7O5S |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | N,N-diethyl-4-[[6-[2-(4-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccc(F)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H22FN7O5S/c1-3-28(4-2)35(33,34)17-11-9-16(10-12-17)25-19-18(29(31)32)20(24-13-23-19)26-27-21(30)14-5-7-15(22)8-6-14/h5-13H,3-4H2,1-2H3,(H,27,30)(H2,23,24,25,26) |
| InChIKey | IYWFAOYDTRPELW-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 159.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|