C19H15FN6O5 — CID 22533720
methyl 4-[[6-[2-(4-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22533720) has the molecular formula C19H15FN6O5 and a molecular weight of 426.36 g/mol. Its IUPAC name is methyl 4-[[6-[2-(4-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[6-[2-(4-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22533720 |
| Molecular Formula | C19H15FN6O5 |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | methyl 4-[[6-[2-(4-fluorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2ncnc(NNC(=O)c3ccc(F)cc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H15FN6O5/c1-31-19(28)12-4-8-14(9-5-12)23-16-15(26(29)30)17(22-10-21-16)24-25-18(27)11-2-6-13(20)7-3-11/h2-10H,1H3,(H,25,27)(H2,21,22,23,24) |
| InChIKey | VYYUCHFGBKJETC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|