C15H17FN6O4 — CID 22526537
4-fluoro-N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]benzohydrazide (PubChem CID 22526537) has the molecular formula C15H17FN6O4 and a molecular weight of 364.34 g/mol. Its IUPAC name is 4-fluoro-N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]benzohydrazide.
| Compound Name | 4-fluoro-N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 22526537 |
| Molecular Formula | C15H17FN6O4 |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 4-fluoro-N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]benzohydrazide |
| SMILES | COCCCNc1ncnc(NNC(=O)c2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17FN6O4/c1-26-8-2-7-17-13-12(22(24)25)14(19-9-18-13)20-21-15(23)10-3-5-11(16)6-4-10/h3-6,9H,2,7-8H2,1H3,(H,21,23)(H2,17,18,19,20) |
| InChIKey | USRAQPHAPRAKNB-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|