C14H17N7O5 — CID 22526474
N-(3-methoxypropyl)-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine (PubChem CID 22526474) has the molecular formula C14H17N7O5 and a molecular weight of 363.33 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine.
| Compound Name | N-(3-methoxypropyl)-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 22526474 |
| Molecular Formula | C14H17N7O5 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | N-(3-methoxypropyl)-5-nitro-6-[2-(4-nitrophenyl)hydrazinyl]pyrimidin-4-amine |
| SMILES | COCCCNc1ncnc(NNc2ccc([N+](=O)[O-])cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N7O5/c1-26-8-2-7-15-13-12(21(24)25)14(17-9-16-13)19-18-10-3-5-11(6-4-10)20(22)23/h3-6,9,18H,2,7-8H2,1H3,(H2,15,16,17,19) |
| InChIKey | BNSQCMGWSZCBSY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 157.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|