C15H17N7O6 — CID 22526543
N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22526543) has the molecular formula C15H17N7O6 and a molecular weight of 391.34 g/mol. Its IUPAC name is N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22526543 |
| Molecular Formula | C15H17N7O6 |
| Molecular Weight | 391.34 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | N'-[6-(3-methoxypropylamino)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | COCCCNc1ncnc(NNC(=O)c2cccc([N+](=O)[O-])c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17N7O6/c1-28-7-3-6-16-13-12(22(26)27)14(18-9-17-13)19-20-15(23)10-4-2-5-11(8-10)21(24)25/h2,4-5,8-9H,3,6-7H2,1H3,(H,20,23)(H2,16,17,18,19) |
| InChIKey | PCSWIGMHNYUXTG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 174.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.34 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|