C15H18N8O5 — CID 22536028
N'-[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22536028) has the molecular formula C15H18N8O5 and a molecular weight of 390.36 g/mol. Its IUPAC name is N'-[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22536028 |
| Molecular Formula | C15H18N8O5 |
| Molecular Weight | 390.36 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | N'-[6-(2-tert-butylhydrazinyl)-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | CC(C)(C)NNc1ncnc(NNC(=O)c2cccc([N+](=O)[O-])c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N8O5/c1-15(2,3)21-19-13-11(23(27)28)12(16-8-17-13)18-20-14(24)9-5-4-6-10(7-9)22(25)26/h4-8,21H,1-3H3,(H,20,24)(H2,16,17,18,19) |
| InChIKey | AXFYIKCREROPRA-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 177.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.36 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|