C25H20N8O6 — CID 22536019
N'-[6-[2-(2,2-diphenylacetyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide (PubChem CID 22536019) has the molecular formula C25H20N8O6 and a molecular weight of 528.49 g/mol. Its IUPAC name is N'-[6-[2-(2,2-diphenylacetyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide.
| Compound Name | N'-[6-[2-(2,2-diphenylacetyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 22536019 |
| Molecular Formula | C25H20N8O6 |
| Molecular Weight | 528.49 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | N'-[6-[2-(2,2-diphenylacetyl)hydrazinyl]-5-nitropyrimidin-4-yl]-3-nitrobenzohydrazide |
| SMILES | O=C(NNc1ncnc(NNC(=O)C(c2ccccc2)c2ccccc2)c1[N+](=O)[O-])c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20N8O6/c34-24(18-12-7-13-19(14-18)32(36)37)30-28-22-21(33(38)39)23(27-15-26-22)29-31-25(35)20(16-8-3-1-4-9-16)17-10-5-2-6-11-17/h1-15,20H,(H,30,34)(H,31,35)(H2,26,27,28,29) |
| InChIKey | FZLWIZMDVVXWRT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 194.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|