C23H19N7O3 — CID 22531084
N'-[5-nitro-6-(pyridin-2-ylamino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 22531084) has the molecular formula C23H19N7O3 and a molecular weight of 441.45 g/mol. Its IUPAC name is N'-[5-nitro-6-(pyridin-2-ylamino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[5-nitro-6-(pyridin-2-ylamino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 22531084 |
| Molecular Formula | C23H19N7O3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | N'-[5-nitro-6-(pyridin-2-ylamino)pyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | O=C(NNc1ncnc(Nc2ccccn2)c1[N+](=O)[O-])C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N7O3/c31-23(19(16-9-3-1-4-10-16)17-11-5-2-6-12-17)29-28-22-20(30(32)33)21(25-15-26-22)27-18-13-7-8-14-24-18/h1-15,19H,(H,29,31)(H2,24,25,26,27,28) |
| InChIKey | HRXLQHAJILDKSE-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 134.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|