C25H22N6O3 — CID 22531951
N'-[6-(2-methylanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide (PubChem CID 22531951) has the molecular formula C25H22N6O3 and a molecular weight of 454.49 g/mol. Its IUPAC name is N'-[6-(2-methylanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide.
| Compound Name | N'-[6-(2-methylanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide |
|---|---|
| PubChem CID | 22531951 |
| Molecular Formula | C25H22N6O3 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | N'-[6-(2-methylanilino)-5-nitropyrimidin-4-yl]-2,2-diphenylacetohydrazide |
| SMILES | Cc1ccccc1Nc1ncnc(NNC(=O)C(c2ccccc2)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H22N6O3/c1-17-10-8-9-15-20(17)28-23-22(31(33)34)24(27-16-26-23)29-30-25(32)21(18-11-4-2-5-12-18)19-13-6-3-7-14-19/h2-16,21H,1H3,(H,30,32)(H2,26,27,28,29) |
| InChIKey | JQEKFDGHPXTKQI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|