C27H24N6O5 — CID 22537012
ethyl 2-[[6-[2-(2,2-diphenylacetyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22537012) has the molecular formula C27H24N6O5 and a molecular weight of 512.53 g/mol. Its IUPAC name is ethyl 2-[[6-[2-(2,2-diphenylacetyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-[2-(2,2-diphenylacetyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22537012 |
| Molecular Formula | C27H24N6O5 |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | ethyl 2-[[6-[2-(2,2-diphenylacetyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(NNC(=O)C(c2ccccc2)c2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C27H24N6O5/c1-2-38-27(35)20-15-9-10-16-21(20)30-24-23(33(36)37)25(29-17-28-24)31-32-26(34)22(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-17,22H,2H2,1H3,(H,32,34)(H2,28,29,30,31) |
| InChIKey | MYSSTEAUSJLDSV-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 148.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|