C20H18FN5O4 — CID 22538613
ethyl 2-[[6-[(4-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22538613) has the molecular formula C20H18FN5O4 and a molecular weight of 411.39 g/mol. Its IUPAC name is ethyl 2-[[6-[(4-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-[(4-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22538613 |
| Molecular Formula | C20H18FN5O4 |
| Molecular Weight | 411.39 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | ethyl 2-[[6-[(4-fluorophenyl)methylamino]-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(NCc2ccc(F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H18FN5O4/c1-2-30-20(27)15-5-3-4-6-16(15)25-19-17(26(28)29)18(23-12-24-19)22-11-13-7-9-14(21)10-8-13/h3-10,12H,2,11H2,1H3,(H2,22,23,24,25) |
| InChIKey | HCKCRXGWUASDRY-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|