C20H16F3N5O4 — CID 22532701
ethyl 2-[[5-nitro-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate (PubChem CID 22532701) has the molecular formula C20H16F3N5O4 and a molecular weight of 447.37 g/mol. Its IUPAC name is ethyl 2-[[5-nitro-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-nitro-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22532701 |
| Molecular Formula | C20H16F3N5O4 |
| Molecular Weight | 447.37 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | ethyl 2-[[5-nitro-6-[3-(trifluoromethyl)anilino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(Nc2cccc(C(F)(F)F)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C20H16F3N5O4/c1-2-32-19(29)14-8-3-4-9-15(14)27-18-16(28(30)31)17(24-11-25-18)26-13-7-5-6-12(10-13)20(21,22)23/h3-11H,2H2,1H3,(H2,24,25,26,27) |
| InChIKey | FBRBODNRLVLKHD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|