C19H15Cl2N5O4 — CID 22534196
ethyl 2-[[6-(2,4-dichloroanilino)-5-nitropyrimidin-4-yl]amino]benzoate (PubChem CID 22534196) has the molecular formula C19H15Cl2N5O4 and a molecular weight of 448.27 g/mol. Its IUPAC name is ethyl 2-[[6-(2,4-dichloroanilino)-5-nitropyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[6-(2,4-dichloroanilino)-5-nitropyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22534196 |
| Molecular Formula | C19H15Cl2N5O4 |
| Molecular Weight | 448.27 g/mol |
| Exact Mass | 447.05 |
| IUPAC Name | ethyl 2-[[6-(2,4-dichloroanilino)-5-nitropyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(Nc2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H15Cl2N5O4/c1-2-30-19(27)12-5-3-4-6-14(12)24-17-16(26(28)29)18(23-10-22-17)25-15-8-7-11(20)9-13(15)21/h3-10H,2H2,1H3,(H2,22,23,24,25) |
| InChIKey | YQXGOWUDOFIYNI-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|