C25H21N7O4 — CID 22529138
ethyl 2-[[5-nitro-6-(4-phenyldiazenylanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 22529138) has the molecular formula C25H21N7O4 and a molecular weight of 483.49 g/mol. Its IUPAC name is ethyl 2-[[5-nitro-6-(4-phenyldiazenylanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-nitro-6-(4-phenyldiazenylanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22529138 |
| Molecular Formula | C25H21N7O4 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | ethyl 2-[[5-nitro-6-(4-phenyldiazenylanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(Nc2ccc(/N=N/c3ccccc3)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C25H21N7O4/c1-2-36-25(33)20-10-6-7-11-21(20)29-24-22(32(34)35)23(26-16-27-24)28-17-12-14-19(15-13-17)31-30-18-8-4-3-5-9-18/h3-16H,2H2,1H3,(H2,26,27,28,29)/b31-30+ |
| InChIKey | CTWRQPVXXOVBGK-NVQSTNCTSA-N |
| XLogP | 6.46 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|