C19H19N5O4S — CID 22539049
ethyl 2-[[5-nitro-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 22539049) has the molecular formula C19H19N5O4S and a molecular weight of 413.46 g/mol. Its IUPAC name is ethyl 2-[[5-nitro-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-nitro-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22539049 |
| Molecular Formula | C19H19N5O4S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | ethyl 2-[[5-nitro-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(NCCc2cccs2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N5O4S/c1-2-28-19(25)14-7-3-4-8-15(14)23-18-16(24(26)27)17(21-12-22-18)20-10-9-13-6-5-11-29-13/h3-8,11-12H,2,9-10H2,1H3,(H2,20,21,22,23) |
| InChIKey | SEGSXDNZJYOQCK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 119.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|