C20H19N5O6S — CID 23486448
dimethyl 5-[[5-nitro-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 23486448) has the molecular formula C20H19N5O6S and a molecular weight of 457.47 g/mol. Its IUPAC name is dimethyl 5-[[5-nitro-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[5-nitro-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23486448 |
| Molecular Formula | C20H19N5O6S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | dimethyl 5-[[5-nitro-6-(2-thiophen-2-ylethylamino)pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc(NCCc3cccs3)c2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H19N5O6S/c1-30-19(26)12-8-13(20(27)31-2)10-14(9-12)24-18-16(25(28)29)17(22-11-23-18)21-6-5-15-4-3-7-32-15/h3-4,7-11H,5-6H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | GQRNNQGIFDTQDT-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|