C21H19N5O7 — CID 23486336
dimethyl 5-[[6-(2-methoxyanilino)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 23486336) has the molecular formula C21H19N5O7 and a molecular weight of 453.41 g/mol. Its IUPAC name is dimethyl 5-[[6-(2-methoxyanilino)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[6-(2-methoxyanilino)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23486336 |
| Molecular Formula | C21H19N5O7 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | dimethyl 5-[[6-(2-methoxyanilino)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc(Nc3ccccc3OC)c2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H19N5O7/c1-31-16-7-5-4-6-15(16)25-19-17(26(29)30)18(22-11-23-19)24-14-9-12(20(27)32-2)8-13(10-14)21(28)33-3/h4-11H,1-3H3,(H2,22,23,24,25) |
| InChIKey | GSKLJCZTIRSCHK-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 154.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|