C21H19N5O6 — CID 23486256
dimethyl 5-[[6-(benzylamino)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 23486256) has the molecular formula C21H19N5O6 and a molecular weight of 437.41 g/mol. Its IUPAC name is dimethyl 5-[[6-(benzylamino)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[6-(benzylamino)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23486256 |
| Molecular Formula | C21H19N5O6 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | dimethyl 5-[[6-(benzylamino)-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc(NCc3ccccc3)c2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H19N5O6/c1-31-20(27)14-8-15(21(28)32-2)10-16(9-14)25-19-17(26(29)30)18(23-12-24-19)22-11-13-6-4-3-5-7-13/h3-10,12H,11H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | HHEKBSKCEVZHPJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 145.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|