C19H18N6O3 — CID 23488211
N-[4-[[6-(benzylamino)-5-nitropyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 23488211) has the molecular formula C19H18N6O3 and a molecular weight of 378.39 g/mol. Its IUPAC name is N-[4-[[6-(benzylamino)-5-nitropyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-(benzylamino)-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 23488211 |
| Molecular Formula | C19H18N6O3 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | N-[4-[[6-(benzylamino)-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ncnc(NCc3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H18N6O3/c1-13(26)23-15-7-9-16(10-8-15)24-19-17(25(27)28)18(21-12-22-19)20-11-14-5-3-2-4-6-14/h2-10,12H,11H2,1H3,(H,23,26)(H2,20,21,22,24) |
| InChIKey | VWLLDVPZPVTFLT-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 122.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|