C18H17N5O2 — CID 22531801
6-N-[(4-methylphenyl)methyl]-5-nitro-4-N-phenylpyrimidine-4,6-diamine (PubChem CID 22531801) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 6-N-[(4-methylphenyl)methyl]-5-nitro-4-N-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[(4-methylphenyl)methyl]-5-nitro-4-N-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22531801 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 6-N-[(4-methylphenyl)methyl]-5-nitro-4-N-phenylpyrimidine-4,6-diamine |
| SMILES | Cc1ccc(CNc2ncnc(Nc3ccccc3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H17N5O2/c1-13-7-9-14(10-8-13)11-19-17-16(23(24)25)18(21-12-20-17)22-15-5-3-2-4-6-15/h2-10,12H,11H2,1H3,(H2,19,20,21,22) |
| InChIKey | XAWMZKILXKVQGW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 92.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|