C18H23N7O4 — CID 22538128
N-[4-[[6-(2-morpholin-4-ylethylamino)-5-nitropyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 22538128) has the molecular formula C18H23N7O4 and a molecular weight of 401.43 g/mol. Its IUPAC name is N-[4-[[6-(2-morpholin-4-ylethylamino)-5-nitropyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[6-(2-morpholin-4-ylethylamino)-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 22538128 |
| Molecular Formula | C18H23N7O4 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | N-[4-[[6-(2-morpholin-4-ylethylamino)-5-nitropyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2ncnc(NCCN3CCOCC3)c2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H23N7O4/c1-13(26)22-14-2-4-15(5-3-14)23-18-16(25(27)28)17(20-12-21-18)19-6-7-24-8-10-29-11-9-24/h2-5,12H,6-11H2,1H3,(H,22,26)(H2,19,20,21,23) |
| InChIKey | HVJBKQLAUAGHNU-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|