C16H19FN6O3 — CID 22533352
4-N-(4-fluorophenyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 22533352) has the molecular formula C16H19FN6O3 and a molecular weight of 362.37 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-fluorophenyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 22533352 |
| Molecular Formula | C16H19FN6O3 |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 4-N-(4-fluorophenyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCOCC2)ncnc1Nc1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FN6O3/c17-12-1-3-13(4-2-12)21-16-14(23(24)25)15(19-11-20-16)18-5-6-22-7-9-26-10-8-22/h1-4,11H,5-10H2,(H2,18,19,20,21) |
| InChIKey | RQNNITLODDFDLR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|