C10H16N6O3 — CID 2959291
4-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 2959291) has the molecular formula C10H16N6O3 and a molecular weight of 268.28 g/mol. Its IUPAC name is 4-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 2959291 |
| Molecular Formula | C10H16N6O3 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | Nc1ncnc(NCCN2CCOCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H16N6O3/c11-9-8(16(17)18)10(14-7-13-9)12-1-2-15-3-5-19-6-4-15/h7H,1-6H2,(H3,11,12,13,14) |
| InChIKey | ZIPRAEGTJNKELY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|