C18H32N6O3 — CID 23493066
4-N,4-N-bis(2-methylpropyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23493066) has the molecular formula C18H32N6O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is 4-N,4-N-bis(2-methylpropyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 4-N,4-N-bis(2-methylpropyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23493066 |
| Molecular Formula | C18H32N6O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 4-N,4-N-bis(2-methylpropyl)-6-N-(2-morpholin-4-ylethyl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CC(C)CN(CC(C)C)c1ncnc(NCCN2CCOCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H32N6O3/c1-14(2)11-23(12-15(3)4)18-16(24(25)26)17(20-13-21-18)19-5-6-22-7-9-27-10-8-22/h13-15H,5-12H2,1-4H3,(H,19,20,21) |
| InChIKey | MARMDBIXRHHAQM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|