C16H27N7O2 — CID 11959076
5-nitro-4-N,6-N-bis(2-pyrrolidin-1-ylethyl)pyrimidine-4,6-diamine (PubChem CID 11959076) has the molecular formula C16H27N7O2 and a molecular weight of 349.44 g/mol. Its IUPAC name is 5-nitro-4-N,6-N-bis(2-pyrrolidin-1-ylethyl)pyrimidine-4,6-diamine.
| Compound Name | 5-nitro-4-N,6-N-bis(2-pyrrolidin-1-ylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 11959076 |
| Molecular Formula | C16H27N7O2 |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 5-nitro-4-N,6-N-bis(2-pyrrolidin-1-ylethyl)pyrimidine-4,6-diamine |
| SMILES | O=[N+]([O-])c1c(NCCN2CCCC2)ncnc1NCCN1CCCC1 |
| InChI | InChI=1S/C16H27N7O2/c24-23(25)14-15(17-5-11-21-7-1-2-8-21)19-13-20-16(14)18-6-12-22-9-3-4-10-22/h13H,1-12H2,(H2,17,18,19,20) |
| InChIKey | UQBGBYUJGTWMIQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|