C10H17N7O2S — CID 106327655
6-hydrazinyl-5-nitro-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine (PubChem CID 106327655) has the molecular formula C10H17N7O2S and a molecular weight of 299.36 g/mol. Its IUPAC name is 6-hydrazinyl-5-nitro-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-5-nitro-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 106327655 |
| Molecular Formula | C10H17N7O2S |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 6-hydrazinyl-5-nitro-N-(2-thiomorpholin-4-ylethyl)pyrimidin-4-amine |
| SMILES | NNc1ncnc(NCCN2CCSCC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H17N7O2S/c11-15-10-8(17(18)19)9(13-7-14-10)12-1-2-16-3-5-20-6-4-16/h7H,1-6,11H2,(H2,12,13,14,15) |
| InChIKey | BOUPFPXFCKDMPP-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|