C11H19N7O2 — CID 80903432
6-hydrazinyl-N-[(1-methylpiperidin-2-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 80903432) has the molecular formula C11H19N7O2 and a molecular weight of 281.32 g/mol. Its IUPAC name is 6-hydrazinyl-N-[(1-methylpiperidin-2-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 6-hydrazinyl-N-[(1-methylpiperidin-2-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 80903432 |
| Molecular Formula | C11H19N7O2 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 6-hydrazinyl-N-[(1-methylpiperidin-2-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | CN1CCCCC1CNc1ncnc(NN)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H19N7O2/c1-17-5-3-2-4-8(17)6-13-10-9(18(19)20)11(16-12)15-7-14-10/h7-8H,2-6,12H2,1H3,(H2,13,14,15,16) |
| InChIKey | JDOIPOLGMHLEHX-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|