C12H19Cl2N5 — CID 102761888
3,5-dichloro-6-hydrazinyl-N-[(1-methylpiperidin-2-yl)methyl]pyridin-2-amine (PubChem CID 102761888) has the molecular formula C12H19Cl2N5 and a molecular weight of 304.23 g/mol. Its IUPAC name is 3,5-dichloro-6-hydrazinyl-N-[(1-methylpiperidin-2-yl)methyl]pyridin-2-amine.
| Compound Name | 3,5-dichloro-6-hydrazinyl-N-[(1-methylpiperidin-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 102761888 |
| Molecular Formula | C12H19Cl2N5 |
| Molecular Weight | 304.23 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3,5-dichloro-6-hydrazinyl-N-[(1-methylpiperidin-2-yl)methyl]pyridin-2-amine |
| SMILES | CN1CCCCC1CNc1nc(NN)c(Cl)cc1Cl |
| InChI | InChI=1S/C12H19Cl2N5/c1-19-5-3-2-4-8(19)7-16-11-9(13)6-10(14)12(17-11)18-15/h6,8H,2-5,7,15H2,1H3,(H2,16,17,18) |
| InChIKey | XZRYWHBOASLELV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|