C11H17F2N5 — CID 106026111
3,5-difluoro-6-hydrazinyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyridin-2-amine (PubChem CID 106026111) has the molecular formula C11H17F2N5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 3,5-difluoro-6-hydrazinyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyridin-2-amine.
| Compound Name | 3,5-difluoro-6-hydrazinyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 106026111 |
| Molecular Formula | C11H17F2N5 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 3,5-difluoro-6-hydrazinyl-N-[(1-methylpyrrolidin-2-yl)methyl]pyridin-2-amine |
| SMILES | CN1CCCC1CNc1nc(NN)c(F)cc1F |
| InChI | InChI=1S/C11H17F2N5/c1-18-4-2-3-7(18)6-15-10-8(12)5-9(13)11(16-10)17-14/h5,7H,2-4,6,14H2,1H3,(H2,15,16,17) |
| InChIKey | UTZXHBDLHMBYJE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 66.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|