C10H17N7O2 — CID 106026114
2-hydrazinyl-N-[(1-methylpyrrolidin-2-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 106026114) has the molecular formula C10H17N7O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 2-hydrazinyl-N-[(1-methylpyrrolidin-2-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-[(1-methylpyrrolidin-2-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 106026114 |
| Molecular Formula | C10H17N7O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-hydrazinyl-N-[(1-methylpyrrolidin-2-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | CN1CCCC1CNc1nc(NN)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H17N7O2/c1-16-4-2-3-7(16)5-12-9-8(17(18)19)6-13-10(14-9)15-11/h6-7H,2-5,11H2,1H3,(H2,12,13,14,15) |
| InChIKey | AOYZLVFGDXSGCT-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|