C9H12N8O2 — CID 114045034
2-hydrazinyl-N-[(2-methylpyrazol-3-yl)methyl]-5-nitropyrimidin-4-amine (PubChem CID 114045034) has the molecular formula C9H12N8O2 and a molecular weight of 264.25 g/mol. Its IUPAC name is 2-hydrazinyl-N-[(2-methylpyrazol-3-yl)methyl]-5-nitropyrimidin-4-amine.
| Compound Name | 2-hydrazinyl-N-[(2-methylpyrazol-3-yl)methyl]-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 114045034 |
| Molecular Formula | C9H12N8O2 |
| Molecular Weight | 264.25 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | 2-hydrazinyl-N-[(2-methylpyrazol-3-yl)methyl]-5-nitropyrimidin-4-amine |
| SMILES | Cn1nccc1CNc1nc(NN)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N8O2/c1-16-6(2-3-13-16)4-11-8-7(17(18)19)5-12-9(14-8)15-10/h2-3,5H,4,10H2,1H3,(H2,11,12,14,15) |
| InChIKey | WKSFWNPUPBIZBB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 136.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|