C13H15N7 — CID 80913958
2-hydrazinyl-N-[(2-methylpyrazol-3-yl)methyl]quinazolin-4-amine (PubChem CID 80913958) has the molecular formula C13H15N7 and a molecular weight of 269.31 g/mol. Its IUPAC name is 2-hydrazinyl-N-[(2-methylpyrazol-3-yl)methyl]quinazolin-4-amine.
| Compound Name | 2-hydrazinyl-N-[(2-methylpyrazol-3-yl)methyl]quinazolin-4-amine |
|---|---|
| PubChem CID | 80913958 |
| Molecular Formula | C13H15N7 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-hydrazinyl-N-[(2-methylpyrazol-3-yl)methyl]quinazolin-4-amine |
| SMILES | Cn1nccc1CNc1nc(NN)nc2ccccc12 |
| InChI | InChI=1S/C13H15N7/c1-20-9(6-7-16-20)8-15-12-10-4-2-3-5-11(10)17-13(18-12)19-14/h2-7H,8,14H2,1H3,(H2,15,17,18,19) |
| InChIKey | BXGZAWVOLRXNHK-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|