C10H12ClN5 — CID 115474161
6-chloro-2-N-[(2-methylpyrazol-3-yl)methyl]pyridine-2,3-diamine (PubChem CID 115474161) has the molecular formula C10H12ClN5 and a molecular weight of 237.69 g/mol. Its IUPAC name is 6-chloro-2-N-[(2-methylpyrazol-3-yl)methyl]pyridine-2,3-diamine.
| Compound Name | 6-chloro-2-N-[(2-methylpyrazol-3-yl)methyl]pyridine-2,3-diamine |
|---|---|
| PubChem CID | 115474161 |
| Molecular Formula | C10H12ClN5 |
| Molecular Weight | 237.69 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 6-chloro-2-N-[(2-methylpyrazol-3-yl)methyl]pyridine-2,3-diamine |
| SMILES | Cn1nccc1CNc1nc(Cl)ccc1N |
| InChI | InChI=1S/C10H12ClN5/c1-16-7(4-5-14-16)6-13-10-8(12)2-3-9(11)15-10/h2-5H,6,12H2,1H3,(H,13,15) |
| InChIKey | ZKBYNQXUXILWBU-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.69 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|