C10H9BrClN3S — CID 115474210
2-N-[(4-bromothiophen-2-yl)methyl]-6-chloropyridine-2,3-diamine (PubChem CID 115474210) has the molecular formula C10H9BrClN3S and a molecular weight of 318.63 g/mol. Its IUPAC name is 2-N-[(4-bromothiophen-2-yl)methyl]-6-chloropyridine-2,3-diamine.
| Compound Name | 2-N-[(4-bromothiophen-2-yl)methyl]-6-chloropyridine-2,3-diamine |
|---|---|
| PubChem CID | 115474210 |
| Molecular Formula | C10H9BrClN3S |
| Molecular Weight | 318.63 g/mol |
| Exact Mass | 316.94 |
| IUPAC Name | 2-N-[(4-bromothiophen-2-yl)methyl]-6-chloropyridine-2,3-diamine |
| SMILES | Nc1ccc(Cl)nc1NCc1cc(Br)cs1 |
| InChI | InChI=1S/C10H9BrClN3S/c11-6-3-7(16-5-6)4-14-10-8(13)1-2-9(12)15-10/h1-3,5H,4,13H2,(H,14,15) |
| InChIKey | ULPFPDYGZKDIEB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.63 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|