C10H9BrClN3OS — CID 80758459
N-[(4-bromothiophen-2-yl)methyl]-5-chloro-2-methoxypyrimidin-4-amine (PubChem CID 80758459) has the molecular formula C10H9BrClN3OS and a molecular weight of 334.63 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-5-chloro-2-methoxypyrimidin-4-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-5-chloro-2-methoxypyrimidin-4-amine |
|---|---|
| PubChem CID | 80758459 |
| Molecular Formula | C10H9BrClN3OS |
| Molecular Weight | 334.63 g/mol |
| Exact Mass | 332.93 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-5-chloro-2-methoxypyrimidin-4-amine |
| SMILES | COc1ncc(Cl)c(NCc2cc(Br)cs2)n1 |
| InChI | InChI=1S/C10H9BrClN3OS/c1-16-10-14-4-8(12)9(15-10)13-3-7-2-6(11)5-17-7/h2,4-5H,3H2,1H3,(H,13,14,15) |
| InChIKey | KMFZZTDRBCMZAV-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.63 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |