C11H12BrN3O2S — CID 113292960
N-[(4-bromothiophen-2-yl)methyl]-4,6-dimethoxypyrimidin-2-amine (PubChem CID 113292960) has the molecular formula C11H12BrN3O2S and a molecular weight of 330.21 g/mol. Its IUPAC name is N-[(4-bromothiophen-2-yl)methyl]-4,6-dimethoxypyrimidin-2-amine.
| Compound Name | N-[(4-bromothiophen-2-yl)methyl]-4,6-dimethoxypyrimidin-2-amine |
|---|---|
| PubChem CID | 113292960 |
| Molecular Formula | C11H12BrN3O2S |
| Molecular Weight | 330.21 g/mol |
| Exact Mass | 328.98 |
| IUPAC Name | N-[(4-bromothiophen-2-yl)methyl]-4,6-dimethoxypyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(NCc2cc(Br)cs2)n1 |
| InChI | InChI=1S/C11H12BrN3O2S/c1-16-9-4-10(17-2)15-11(14-9)13-5-8-3-7(12)6-18-8/h3-4,6H,5H2,1-2H3,(H,13,14,15) |
| InChIKey | XMCQQEQDKBVAEU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.21 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |