C8H10F3N3O2 — CID 115354935
4,6-dimethoxy-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine (PubChem CID 115354935) has the molecular formula C8H10F3N3O2 and a molecular weight of 237.18 g/mol. Its IUPAC name is 4,6-dimethoxy-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine.
| Compound Name | 4,6-dimethoxy-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 115354935 |
| Molecular Formula | C8H10F3N3O2 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.07 |
| IUPAC Name | 4,6-dimethoxy-N-(2,2,2-trifluoroethyl)pyrimidin-2-amine |
| SMILES | COc1cc(OC)nc(NCC(F)(F)F)n1 |
| InChI | InChI=1S/C8H10F3N3O2/c1-15-5-3-6(16-2)14-7(13-5)12-4-8(9,10)11/h3H,4H2,1-2H3,(H,12,13,14) |
| InChIKey | WGECCCOCJLOZPU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |