About 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol
3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol (PubChem CID 115355171) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol.
Molecular Properties
| Compound Name | 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol |
| PubChem CID | 115355171 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol |
| SMILES | CCC(O)(CC)CNc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C12H21N3O3/c1-5-12(16,6-2)8-13-11-14-9(17-3)7-10(15-11)18-4/h7,16H,5-6,8H2,1-4H3,(H,13,14,15) |
| InChIKey | UCQYATYAOMEZRE-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol?
The IUPAC name of 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol (CID 115355171) is 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol.
What is the SMILES notation for 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol?
The canonical SMILES for 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol is CCC(O)(CC)CNc1nc(OC)cc(OC)n1.
What is the InChIKey of 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol?
The InChIKey is UCQYATYAOMEZRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O3/c1-5-12(16,6-2)8-13-11-14-9(17-3)7-10(15-11)18-4/h7,16H,5-6,8H2,1-4H3,(H,13,14,15).
What are the key properties of 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol?
3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol has a molecular weight of 255.32 g/mol, XLogP of 1.46, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(4,6-dimethoxypyrimidin-2-yl)amino]methyl]pentan-3-ol is sourced from PubChem (CID 115355171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).