About methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate
methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate (PubChem CID 115355512) has the molecular formula C13H21N3O4
and a molecular weight of 283.33 g/mol. Its IUPAC name is methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate.
Molecular Properties
| Compound Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate |
| PubChem CID | 115355512 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate |
| SMILES | CCCC(C)(Nc1nc(OC)cc(OC)n1)C(=O)OC |
| InChI | InChI=1S/C13H21N3O4/c1-6-7-13(2,11(17)20-5)16-12-14-9(18-3)8-10(15-12)19-4/h8H,6-7H2,1-5H3,(H,14,15,16) |
| InChIKey | CSHWYUYAORSFTQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate?
The IUPAC name of methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate (CID 115355512) is methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate.
What is the SMILES notation for methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate?
The canonical SMILES for methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate is CCCC(C)(Nc1nc(OC)cc(OC)n1)C(=O)OC.
What is the InChIKey of methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate?
The InChIKey is CSHWYUYAORSFTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N3O4/c1-6-7-13(2,11(17)20-5)16-12-14-9(18-3)8-10(15-12)19-4/h8H,6-7H2,1-5H3,(H,14,15,16).
What are the key properties of methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate?
methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate has a molecular weight of 283.33 g/mol, XLogP of 1.64, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-methylpentanoate is sourced from PubChem (CID 115355512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).