C12H19N3O4 — CID 115354788
2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-ethylbutanoic acid (PubChem CID 115354788) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-ethylbutanoic acid.
| Compound Name | 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-ethylbutanoic acid |
|---|---|
| PubChem CID | 115354788 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[(4,6-dimethoxypyrimidin-2-yl)amino]-2-ethylbutanoic acid |
| SMILES | CCC(CC)(Nc1nc(OC)cc(OC)n1)C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-5-12(6-2,10(16)17)15-11-13-8(18-3)7-9(14-11)19-4/h7H,5-6H2,1-4H3,(H,16,17)(H,13,14,15) |
| InChIKey | ULCPALMBWKEGKZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |