C12H14F6N4O4 — CID 7039775
ethyl N-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate (PubChem CID 7039775) has the molecular formula C12H14F6N4O4 and a molecular weight of 392.26 g/mol. Its IUPAC name is ethyl N-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate.
| Compound Name | ethyl N-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate |
|---|---|
| PubChem CID | 7039775 |
| Molecular Formula | C12H14F6N4O4 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | ethyl N-[2-[(4,6-dimethoxypyrimidin-2-yl)amino]-1,1,1,3,3,3-hexafluoropropan-2-yl]carbamate |
| SMILES | CCOC(=O)NC(Nc1nc(OC)cc(OC)n1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H14F6N4O4/c1-4-26-9(23)22-10(11(13,14)15,12(16,17)18)21-8-19-6(24-2)5-7(20-8)25-3/h5H,4H2,1-3H3,(H,22,23)(H,19,20,21) |
| InChIKey | TZJPOXOAJGRKDQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|