C11H14N2O5 — CID 59864605
ethyl 3-(4,6-dimethoxypyrimidin-2-yl)-3-oxopropanoate (PubChem CID 59864605) has the molecular formula C11H14N2O5 and a molecular weight of 254.24 g/mol. Its IUPAC name is ethyl 3-(4,6-dimethoxypyrimidin-2-yl)-3-oxopropanoate.
| Compound Name | ethyl 3-(4,6-dimethoxypyrimidin-2-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 59864605 |
| Molecular Formula | C11H14N2O5 |
| Molecular Weight | 254.24 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | ethyl 3-(4,6-dimethoxypyrimidin-2-yl)-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)c1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C11H14N2O5/c1-4-18-10(15)5-7(14)11-12-8(16-2)6-9(13-11)17-3/h6H,4-5H2,1-3H3 |
| InChIKey | WCEOXAKMNOMPGI-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|